N-Acetilglukozamin: razlika između verzija

Dodano 129 bajtova ,  prije 2 godine
nema sažetka izmjene
[pregledana izmjena][pregledana izmjena]
No edit summary
{{DISPLAYTITLE:''N''-Acetilglukozamin}}
{{Infokutija hemijski spoj|Boja=Lightblue
| Strukturna formula = [[Datoteka:N-Acetylglucosamine.svg|200px]] <br>[[Datoteka:Haworth projection of N-Acetylglucosamine.svg |250px200px]]
| Hemijski spoj = ''N''-Acetilglukozamin
| Druga imena = ''N''-Acetil-<small>D</small>-glucozaminglukozamin<br>GlcNAc<br>NAG <br/>[[IUPAC]] -ime: 2β-<small>D</small>-(Acetilamino)-2-dezoksi-Ddeoksi-glukozaglukopiranoza
| Sumarna formula = C<sub>8</sub>H<sub>15</sub> NO<sub>6</sub>
| CAS registarski broj = 7512-17-6
| SMILES = O=C(N[C@@H]1[C@@H](O)[C@H](O)[C@H](O[C@H]1O)CO)C
| InChI =1/C8H15NO6/c1-3(11)9-5-7(13)6(12)4(2-10)15-8(5)14/h4-8,10,12-14H,2H2,1H3,(H,9,11)/t4-,5-,6-,7-,8-/m1/s1
570

izmjena