Razlika između izmjena na stranici "Međunarodni hemijski identifikator"

<tt>InChI=1S/C2H6O/c1-2-3/h3H,2H2,1H3</tt> (standard InChI)
|-
|align="center"|[[Image:L-ascorbic acid with InChI numbering.svg|thumb]]<br /><small>L</small>-[[ascorbinskaaskorbinska kiselina]]
|<tt>InChI=1/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-10H,1H2/t2-,5+/m0/s1</tt><br />
<tt>InChI=1S/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-8,10-11H,1H2/t2-,5+/m0/s1</tt> (standard InChI)
23.119

izmjena